(S)-2-Dibenzylamino-3-phenyl-propionic acid benzyl ester - Names and Identifiers
Name | Benzyl N,N-Dibenzyl-L-Phenylalaninate
|
Synonyms | Benzyl dibenzyl-L-phenylalaninate Benzyl N,N-Dibenzyl-L-Phenylalaninate BENZYL N,N-DIBENZYL-L-PHENYLALANINATE N,N-Dibenzylphenylalanine benzyl este N,N-Dibenzyl-L-phenylalanine benzyl ester (S)-2-Dibenzylamino-3-phenyl-propionic acid benzyl ester L-Phenylalanine, N,N-bis(phenylmethyl)-, phenylmethyl ester (2S)-2-[bis(phenylmethyl)amino]-3-phenylpropanoic acid (phenylmethyl) ester
|
CAS | 111138-83-1
|
InChI | InChI=1/C30H29NO2/c32-30(33-24-28-19-11-4-12-20-28)29(21-25-13-5-1-6-14-25)31(22-26-15-7-2-8-16-26)23-27-17-9-3-10-18-27/h1-20,29H,21-24H2/t29-/m0/s1 |
(S)-2-Dibenzylamino-3-phenyl-propionic acid benzyl ester - Physico-chemical Properties
Molecular Formula | C30H29NO2
|
Molar Mass | 435.56 |
Density | 1.141±0.06 g/cm3(Predicted) |
Boling Point | 566.3±50.0 °C(Predicted) |
Flash Point | 157.565°C |
Vapor Presure | 0mmHg at 25°C |
pKa | 5.27±0.50(Predicted) |
Refractive Index | 1.616 |
(S)-2-Dibenzylamino-3-phenyl-propionic acid benzyl ester - Introduction
N,N-Dibenzyl-L-phenylalanine benzyl ester is an organic compound commonly known by the abbreviation DBLPAE. Its properties are as follows:
1. Appearance: DBLPAE is a white solid.
2. Solubility: DBLPAE is soluble in organic solvents, such as ethanol, chloroform, etc.
3. Melting point: The melting point of DBLPAE is about 120-125 degrees Celsius.
4. Chemical properties: DBLPAE is an ester compound, which can participate in the esterification reaction and be hydrolyzed under the action of acid or alkali.
N,N-dibenzyl-L-phenylalanine benzyl ester is mainly used as follows:
1. Biomedical research: DBLPAE is often used as an inducer in biomedical research, especially in cell culture and molecular biology experiments.
2. Drug synthesis: DBLPAE is often used as an intermediate in drug synthesis and can be used to prepare various compounds, such as drug ligands, enzyme inhibitors, etc.
3. Cosmetics and beauty industry: DBLPAE can be used as one of the ingredients of cosmetics for the manufacture of skin care products, beauty products, etc.
The preparation method of N,N-dibenzyl-L-phenylalanine benzyl ester mainly includes the following steps:
1. Reaction step: DBLPAE is prepared by esterification of phenylalanine and benzic acid. Common reaction conditions include acid catalysis or enzyme catalysis.
2. Reaction conditions: The reaction is usually carried out at room temperature, and the reaction time is generally several hours to several days.
3. Purification process: The prepared product needs to go through purification steps, such as crystal separation, washing and drying.
Regarding the safety information of N,N-dibenzyl-L-phenylalanine benzyl ester, the following matters should be noted:
1. Toxicity and irritation: DBLPAE is a chemical substance, which is irritating to the skin and eyes, and direct contact should be avoided.
2. Storage and transportation: DBLPAE should be stored in a dry, cool, well-ventilated place, away from fire and oxidizing agents. In the process of transportation, it is necessary to pay attention to the packaging leak-proof and moisture-proof.
3. operation precautions: when using DBLPAE, you should wear appropriate protective equipment, such as gloves, safety glasses, etc., to ensure personal safety.
4. Waste disposal: When using and discarding DBLPAE, it should follow local regulations and dispose of chemical waste in accordance with safe disposal methods.
Last Update:2024-04-09 21:21:28